C14H17N3O3 — CID 138390077
4'-imino-1'-(2-methoxyethyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2'-one (PubChem CID 138390077) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4'-imino-1'-(2-methoxyethyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2'-one.
| Compound Name | 4'-imino-1'-(2-methoxyethyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 138390077 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4'-imino-1'-(2-methoxyethyl)spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2'-one |
| SMILES | [H]/N=C1\NC(=O)N(CCOC)C12CCOc1ccccc12 |
| InChI | InChI=1S/C14H17N3O3/c1-19-9-7-17-13(18)16-12(15)14(17)6-8-20-11-5-3-2-4-10(11)14/h2-5H,6-9H2,1H3,(H2,15,16,18) |
| InChIKey | CAHLEQZLGWYKIF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|