C13H23N3O2 — CID 138389785
4-imino-1-(2-methoxyethyl)-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 138389785) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-imino-1-(2-methoxyethyl)-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 4-imino-1-(2-methoxyethyl)-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138389785 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 4-imino-1-(2-methoxyethyl)-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CCOC)C12CCC(C)C(C)C2 |
| InChI | InChI=1S/C13H23N3O2/c1-9-4-5-13(8-10(9)2)11(14)15-12(17)16(13)6-7-18-3/h9-10H,4-8H2,1-3H3,(H2,14,15,17) |
| InChIKey | IBXMOWXFQUMNBR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|