About 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one
1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 138390897) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one |
| PubChem CID | 138390897 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(Cc2ccccc2)C12CCC(C)C(C)C2 |
| InChI | InChI=1S/C17H23N3O/c1-12-8-9-17(10-13(12)2)15(18)19-16(21)20(17)11-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H2,18,19,21) |
| InChIKey | JDGQURXVBNOHAK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one?
The IUPAC name of 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one (CID 138390897) is 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one.
What is the SMILES notation for 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one?
The canonical SMILES for 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one is [H]/N=C1\NC(=O)N(Cc2ccccc2)C12CCC(C)C(C)C2.
What is the InChIKey of 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one?
The InChIKey is JDGQURXVBNOHAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O/c1-12-8-9-17(10-13(12)2)15(18)19-16(21)20(17)11-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H2,18,19,21).
What are the key properties of 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one?
1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one has a molecular weight of 285.39 g/mol, XLogP of 3.38, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one is sourced from PubChem (CID 138390897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).