C17H23N3O — CID 138390897
1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 138390897) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138390897 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-benzyl-4-imino-7,8-dimethyl-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(Cc2ccccc2)C12CCC(C)C(C)C2 |
| InChI | InChI=1S/C17H23N3O/c1-12-8-9-17(10-13(12)2)15(18)19-16(21)20(17)11-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H2,18,19,21) |
| InChIKey | JDGQURXVBNOHAK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|