C10H17N3O — CID 138390452
1-ethyl-4-imino-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 138390452) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-ethyl-4-imino-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 1-ethyl-4-imino-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138390452 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-ethyl-4-imino-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC)C12CCCCC2 |
| InChI | InChI=1S/C10H17N3O/c1-2-13-9(14)12-8(11)10(13)6-4-3-5-7-10/h2-7H2,1H3,(H2,11,12,14) |
| InChIKey | OSKCUPFZVUBCOG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|