C15H27N3O — CID 138389767
8-tert-butyl-1-ethyl-4-imino-1,3-diazaspiro[4.6]undecan-2-one (PubChem CID 138389767) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 8-tert-butyl-1-ethyl-4-imino-1,3-diazaspiro[4.6]undecan-2-one.
| Compound Name | 8-tert-butyl-1-ethyl-4-imino-1,3-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 138389767 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 8-tert-butyl-1-ethyl-4-imino-1,3-diazaspiro[4.6]undecan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC)C12CCCC(C(C)(C)C)CC2 |
| InChI | InChI=1S/C15H27N3O/c1-5-18-13(19)17-12(16)15(18)9-6-7-11(8-10-15)14(2,3)4/h11H,5-10H2,1-4H3,(H2,16,17,19) |
| InChIKey | HCLLDDHIKPOMDJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|