C11H20N4O — CID 138388776
4-imino-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 138388776) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-imino-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-imino-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138388776 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4-imino-1-(2-methylpropyl)-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC(C)C)C12CCNCC2 |
| InChI | InChI=1S/C11H20N4O/c1-8(2)7-15-10(16)14-9(12)11(15)3-5-13-6-4-11/h8,13H,3-7H2,1-2H3,(H2,12,14,16) |
| InChIKey | VHBVVRBNSBAZLL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 68.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|