C11H19N3O3S — CID 138389423
4-imino-1-(2-methylpropyl)-8,8-dioxo-8λ6-thia-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 138389423) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 4-imino-1-(2-methylpropyl)-8,8-dioxo-8λ6-thia-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 4-imino-1-(2-methylpropyl)-8,8-dioxo-8λ6-thia-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138389423 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-imino-1-(2-methylpropyl)-8,8-dioxo-8λ6-thia-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC(C)C)C12CCS(=O)(=O)CC2 |
| InChI | InChI=1S/C11H19N3O3S/c1-8(2)7-14-10(15)13-9(12)11(14)3-5-18(16,17)6-4-11/h8H,3-7H2,1-2H3,(H2,12,13,15) |
| InChIKey | DGCGVGCRNBYYAB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|