C15H18FN3O — CID 138391458
7-fluoro-4'-imino-1'-(2-methylpropyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one (PubChem CID 138391458) has the molecular formula C15H18FN3O and a molecular weight of 275.33 g/mol. Its IUPAC name is 7-fluoro-4'-imino-1'-(2-methylpropyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one.
| Compound Name | 7-fluoro-4'-imino-1'-(2-methylpropyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 138391458 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 7-fluoro-4'-imino-1'-(2-methylpropyl)spiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one |
| SMILES | [H]/N=C1\NC(=O)N(CC(C)C)C12CCc1c(F)cccc12 |
| InChI | InChI=1S/C15H18FN3O/c1-9(2)8-19-14(20)18-13(17)15(19)7-6-10-11(15)4-3-5-12(10)16/h3-5,9H,6-8H2,1-2H3,(H2,17,18,20) |
| InChIKey | JEUDAYVPMBQTCA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|