C12H13N3O — CID 138388524
4'-imino-1'-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one (PubChem CID 138388524) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 4'-imino-1'-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one.
| Compound Name | 4'-imino-1'-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 138388524 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4'-imino-1'-methylspiro[1,2-dihydroindene-3,5'-imidazolidine]-2'-one |
| SMILES | [H]/N=C1\NC(=O)N(C)C12CCc1ccccc12 |
| InChI | InChI=1S/C12H13N3O/c1-15-11(16)14-10(13)12(15)7-6-8-4-2-3-5-9(8)12/h2-5H,6-7H2,1H3,(H2,13,14,16) |
| InChIKey | QUAHBTLWLGLJRV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|