C9H16N4O — CID 138388239
4-imino-1,8-dimethyl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 138388239) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-imino-1,8-dimethyl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-imino-1,8-dimethyl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138388239 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-imino-1,8-dimethyl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C)C12CCN(C)CC2 |
| InChI | InChI=1S/C9H16N4O/c1-12-5-3-9(4-6-12)7(10)11-8(14)13(9)2/h3-6H2,1-2H3,(H2,10,11,14) |
| InChIKey | LHNBWLOAKPXSHJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|