C10H19N3O — CID 138388406
5-ethyl-4-imino-5-methyl-1-(2-methylpropyl)imidazolidin-2-one (PubChem CID 138388406) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-ethyl-4-imino-5-methyl-1-(2-methylpropyl)imidazolidin-2-one.
| Compound Name | 5-ethyl-4-imino-5-methyl-1-(2-methylpropyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 138388406 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 5-ethyl-4-imino-5-methyl-1-(2-methylpropyl)imidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC(C)C)C1(C)CC |
| InChI | InChI=1S/C10H19N3O/c1-5-10(4)8(11)12-9(14)13(10)6-7(2)3/h7H,5-6H2,1-4H3,(H2,11,12,14) |
| InChIKey | VHJBKQFKLSRFGP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|