C11H19N3O — CID 138390658
5-ethyl-4-imino-5-propan-2-yl-1-prop-2-enylimidazolidin-2-one (PubChem CID 138390658) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 5-ethyl-4-imino-5-propan-2-yl-1-prop-2-enylimidazolidin-2-one.
| Compound Name | 5-ethyl-4-imino-5-propan-2-yl-1-prop-2-enylimidazolidin-2-one |
|---|---|
| PubChem CID | 138390658 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 5-ethyl-4-imino-5-propan-2-yl-1-prop-2-enylimidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(CC=C)C1(CC)C(C)C |
| InChI | InChI=1S/C11H19N3O/c1-5-7-14-10(15)13-9(12)11(14,6-2)8(3)4/h5,8H,1,6-7H2,2-4H3,(H2,12,13,15) |
| InChIKey | MMRSINIFNTYADG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|