About 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one
5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one (PubChem CID 138388444) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one |
| PubChem CID | 138388444 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C)C1(C)C(C)CC |
| InChI | InChI=1S/C9H17N3O/c1-5-6(2)9(3)7(10)11-8(13)12(9)4/h6H,5H2,1-4H3,(H2,10,11,13) |
| InChIKey | CGOBPEZWYZRPBK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one?
The IUPAC name of 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one (CID 138388444) is 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one.
What is the SMILES notation for 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one?
The canonical SMILES for 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one is [H]/N=C1\NC(=O)N(C)C1(C)C(C)CC.
What is the InChIKey of 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one?
The InChIKey is CGOBPEZWYZRPBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-5-6(2)9(3)7(10)11-8(13)12(9)4/h6H,5H2,1-4H3,(H2,10,11,13).
What are the key properties of 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one?
5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one has a molecular weight of 183.25 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-4-imino-1,5-dimethylimidazolidin-2-one is sourced from PubChem (CID 138388444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).