C10H17N3O2 — CID 138388521
4-imino-1,7,7-trimethyl-8-oxa-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 138388521) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-imino-1,7,7-trimethyl-8-oxa-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 4-imino-1,7,7-trimethyl-8-oxa-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138388521 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 4-imino-1,7,7-trimethyl-8-oxa-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C)C12CCOC(C)(C)C2 |
| InChI | InChI=1S/C10H17N3O2/c1-9(2)6-10(4-5-15-9)7(11)12-8(14)13(10)3/h4-6H2,1-3H3,(H2,11,12,14) |
| InChIKey | VTRSVRFEENNMTM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|