C9H14N2O2S — CID 143147006
2-imino-7,7-dimethyl-8-oxa-1-thia-3-azaspiro[4.5]decan-4-one (PubChem CID 143147006) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-imino-7,7-dimethyl-8-oxa-1-thia-3-azaspiro[4.5]decan-4-one.
| Compound Name | 2-imino-7,7-dimethyl-8-oxa-1-thia-3-azaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 143147006 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-imino-7,7-dimethyl-8-oxa-1-thia-3-azaspiro[4.5]decan-4-one |
| SMILES | [H]/N=C1/NC(=O)C2(CCOC(C)(C)C2)S1 |
| InChI | InChI=1S/C9H14N2O2S/c1-8(2)5-9(3-4-13-8)6(12)11-7(10)14-9/h3-5H2,1-2H3,(H2,10,11,12) |
| InChIKey | PGSUDVSBIKPDMG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|