C3H5N3S2 — CID 176522482
1,3,5-dithiazinane-4,6-diimine (PubChem CID 176522482) has the molecular formula C3H5N3S2 and a molecular weight of 147.23 g/mol. Its IUPAC name is 1,3,5-dithiazinane-4,6-diimine.
| Compound Name | 1,3,5-dithiazinane-4,6-diimine |
|---|---|
| PubChem CID | 176522482 |
| Molecular Formula | C3H5N3S2 |
| Molecular Weight | 147.23 g/mol |
| Exact Mass | 146.99 |
| IUPAC Name | 1,3,5-dithiazinane-4,6-diimine |
| SMILES | [H]/N=C1/N/C(=N/[H])SCS1 |
| InChI | InChI=1S/C3H5N3S2/c4-2-6-3(5)8-1-7-2/h1H2,(H3,4,5,6) |
| InChIKey | GZSWSZUZJFCFHF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 59.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|