C9H15N3O2 — CID 138388436
4-imino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]decan-2-one (PubChem CID 138388436) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-imino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]decan-2-one.
| Compound Name | 4-imino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138388436 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-imino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]decan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C)C12CCOC(C)C2 |
| InChI | InChI=1S/C9H15N3O2/c1-6-5-9(3-4-14-6)7(10)11-8(13)12(9)2/h6H,3-5H2,1-2H3,(H2,10,11,13) |
| InChIKey | SKNQVAPXTVVRGM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|