C10H16N4O — CID 138388942
1-cyclopropyl-4-imino-7-methyl-1,3,7-triazaspiro[4.4]nonan-2-one (PubChem CID 138388942) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-cyclopropyl-4-imino-7-methyl-1,3,7-triazaspiro[4.4]nonan-2-one.
| Compound Name | 1-cyclopropyl-4-imino-7-methyl-1,3,7-triazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 138388942 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-cyclopropyl-4-imino-7-methyl-1,3,7-triazaspiro[4.4]nonan-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C2CC2)C12CCN(C)C2 |
| InChI | InChI=1S/C10H16N4O/c1-13-5-4-10(6-13)8(11)12-9(15)14(10)7-2-3-7/h7H,2-6H2,1H3,(H2,11,12,15) |
| InChIKey | YDLBBKBDTUMNBK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|