C13H17N3O — CID 138388722
4-imino-1,5-dimethyl-5-(2-phenylethyl)imidazolidin-2-one (PubChem CID 138388722) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-imino-1,5-dimethyl-5-(2-phenylethyl)imidazolidin-2-one.
| Compound Name | 4-imino-1,5-dimethyl-5-(2-phenylethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 138388722 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-imino-1,5-dimethyl-5-(2-phenylethyl)imidazolidin-2-one |
| SMILES | [H]/N=C1\NC(=O)N(C)C1(C)CCc1ccccc1 |
| InChI | InChI=1S/C13H17N3O/c1-13(11(14)15-12(17)16(13)2)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H2,14,15,17) |
| InChIKey | RYFPZPCRPVRIDF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|