C26H27N3O — CID 610510
3-benzyl-1-tert-butyl-2-imino-5,5-diphenylimidazolidin-4-one (PubChem CID 610510) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-benzyl-1-tert-butyl-2-imino-5,5-diphenylimidazolidin-4-one.
| Compound Name | 3-benzyl-1-tert-butyl-2-imino-5,5-diphenylimidazolidin-4-one |
|---|---|
| PubChem CID | 610510 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 3-benzyl-1-tert-butyl-2-imino-5,5-diphenylimidazolidin-4-one |
| SMILES | [H]/N=C1/N(Cc2ccccc2)C(=O)C(c2ccccc2)(c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/C26H27N3O/c1-25(2,3)29-24(27)28(19-20-13-7-4-8-14-20)23(30)26(29,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,27H,19H2,1-3H3/b27-24- |
| InChIKey | UIXNWPIVIIAOQY-PNHLSOANSA-N |
| XLogP | 5.01 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|