C11H11N3 — CID 151437818
1-benzylpyrrole-2,5-diimine (PubChem CID 151437818) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-benzylpyrrole-2,5-diimine.
| Compound Name | 1-benzylpyrrole-2,5-diimine |
|---|---|
| PubChem CID | 151437818 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-benzylpyrrole-2,5-diimine |
| SMILES | [H]/N=C1\C=C/C(=N\[H])N1Cc1ccccc1 |
| InChI | InChI=1S/C11H11N3/c12-10-6-7-11(13)14(10)8-9-4-2-1-3-5-9/h1-7,12-13H,8H2/b12-10+,13-11+ |
| InChIKey | PDWROWSOESUXGT-DCIPZJNNSA-N |
| XLogP | 2.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|