About 10-benzylphenoselenazine
10-benzylphenoselenazine (PubChem CID 21409567) has the molecular formula C19H15NSe
and a molecular weight of 336.30 g/mol. Its IUPAC name is 10-benzylphenoselenazine.
Molecular Properties
| Compound Name | 10-benzylphenoselenazine |
| PubChem CID | 21409567 |
| Molecular Formula | C19H15NSe |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 10-benzylphenoselenazine |
| SMILES | c1ccc(CN2c3ccccc3[Se]c3ccccc32)cc1 |
| InChI | InChI=1S/C19H15NSe/c1-2-8-15(9-3-1)14-20-16-10-4-6-12-18(16)21-19-13-7-5-11-17(19)20/h1-13H,14H2 |
| InChIKey | UTPBGDQSYKLMKF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 10-benzylphenoselenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-benzylphenoselenazine?
The IUPAC name of 10-benzylphenoselenazine (CID 21409567) is 10-benzylphenoselenazine.
What is the SMILES notation for 10-benzylphenoselenazine?
The canonical SMILES for 10-benzylphenoselenazine is c1ccc(CN2c3ccccc3[Se]c3ccccc32)cc1.
What is the InChIKey of 10-benzylphenoselenazine?
The InChIKey is UTPBGDQSYKLMKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NSe/c1-2-8-15(9-3-1)14-20-16-10-4-6-12-18(16)21-19-13-7-5-11-17(19)20/h1-13H,14H2.
What are the key properties of 10-benzylphenoselenazine?
10-benzylphenoselenazine has a molecular weight of 336.30 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-benzylphenoselenazine is sourced from PubChem (CID 21409567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).