C21H17NO2S — CID 170013648
10-benzyl-3-ethenylphenothiazine 5,5-dioxide (PubChem CID 170013648) has the molecular formula C21H17NO2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 10-benzyl-3-ethenylphenothiazine 5,5-dioxide.
| Compound Name | 10-benzyl-3-ethenylphenothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 170013648 |
| Molecular Formula | C21H17NO2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 10-benzyl-3-ethenylphenothiazine 5,5-dioxide |
| SMILES | C=Cc1ccc2c(c1)S(=O)(=O)c1ccccc1N2Cc1ccccc1 |
| InChI | InChI=1S/C21H17NO2S/c1-2-16-12-13-19-21(14-16)25(23,24)20-11-7-6-10-18(20)22(19)15-17-8-4-3-5-9-17/h2-14H,1,15H2 |
| InChIKey | NKXKDKCAVPTAEX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |