C15H13N3O — CID 3384405
3-benzyl-5-phenyl-1,3,4-oxadiazol-2-imine (PubChem CID 3384405) has the molecular formula C15H13N3O and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-benzyl-5-phenyl-1,3,4-oxadiazol-2-imine.
| Compound Name | 3-benzyl-5-phenyl-1,3,4-oxadiazol-2-imine |
|---|---|
| PubChem CID | 3384405 |
| Molecular Formula | C15H13N3O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-benzyl-5-phenyl-1,3,4-oxadiazol-2-imine |
| SMILES | [H]/N=c1\oc(-c2ccccc2)nn1Cc1ccccc1 |
| InChI | InChI=1S/C15H13N3O/c16-15-18(11-12-7-3-1-4-8-12)17-14(19-15)13-9-5-2-6-10-13/h1-10,16H,11H2/b16-15- |
| InChIKey | HEKNQGFCPQJOIM-NXVVXOECSA-N |
| XLogP | 2.67 |
| TPSA | 54.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |