C18H12ClNO3 — CID 122221121
(3S)-4'-(4-chlorophenyl)spiro[1H-indole-3,2'-3H-pyran]-2,6'-dione (PubChem CID 122221121) has the molecular formula C18H12ClNO3 and a molecular weight of 325.75 g/mol. Its IUPAC name is (3S)-4'-(4-chlorophenyl)spiro[1H-indole-3,2'-3H-pyran]-2,6'-dione.
| Compound Name | (3S)-4'-(4-chlorophenyl)spiro[1H-indole-3,2'-3H-pyran]-2,6'-dione |
|---|---|
| PubChem CID | 122221121 |
| Molecular Formula | C18H12ClNO3 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | (3S)-4'-(4-chlorophenyl)spiro[1H-indole-3,2'-3H-pyran]-2,6'-dione |
| SMILES | O=C1C=C(c2ccc(Cl)cc2)C[C@@]2(O1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H12ClNO3/c19-13-7-5-11(6-8-13)12-9-16(21)23-18(10-12)14-3-1-2-4-15(14)20-17(18)22/h1-9H,10H2,(H,20,22)/t18-/m0/s1 |
| InChIKey | VZBWIALSZZLQNN-SFHVURJKSA-N |
| XLogP | 3.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |