C18H10ClNO5 — CID 95166402
(3R)-4'-[(4-chlorophenyl)-hydroxymethylidene]spiro[1H-indole-3,5'-oxolane]-2,2',3'-trione (PubChem CID 95166402) has the molecular formula C18H10ClNO5 and a molecular weight of 355.73 g/mol. Its IUPAC name is (3R)-4'-[(4-chlorophenyl)-hydroxymethylidene]spiro[1H-indole-3,5'-oxolane]-2,2',3'-trione.
| Compound Name | (3R)-4'-[(4-chlorophenyl)-hydroxymethylidene]spiro[1H-indole-3,5'-oxolane]-2,2',3'-trione |
|---|---|
| PubChem CID | 95166402 |
| Molecular Formula | C18H10ClNO5 |
| Molecular Weight | 355.73 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | (3R)-4'-[(4-chlorophenyl)-hydroxymethylidene]spiro[1H-indole-3,5'-oxolane]-2,2',3'-trione |
| SMILES | O=C1O[C@@]2(C(=O)Nc3ccccc32)C(=C(O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C18H10ClNO5/c19-10-7-5-9(6-8-10)14(21)13-15(22)16(23)25-18(13)11-3-1-2-4-12(11)20-17(18)24/h1-8,21H,(H,20,24)/t18-/m1/s1 |
| InChIKey | LRWBAKNDCRWVSX-GOSISDBHSA-N |
| XLogP | 2.58 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.73 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|