About methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate
methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate (PubChem CID 172994564) has the molecular formula C19H12ClFN2O5
and a molecular weight of 402.77 g/mol. Its IUPAC name is methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate.
Molecular Properties
| Compound Name | methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate |
| PubChem CID | 172994564 |
| Molecular Formula | C19H12ClFN2O5 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(F)c(Cl)c2)C(=O)OC12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C19H12ClFN2O5/c1-27-16(24)14-15(22-9-6-7-12(21)11(20)8-9)17(25)28-19(14)10-4-2-3-5-13(10)23-18(19)26/h2-8,22H,1H3,(H,23,26) |
| InChIKey | WEUJZJHRSBMSCY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate?
The IUPAC name of methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate (CID 172994564) is methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate.
What is the SMILES notation for methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate?
The canonical SMILES for methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate is COC(=O)C1=C(Nc2ccc(F)c(Cl)c2)C(=O)OC12C(=O)Nc1ccccc12.
What is the InChIKey of methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate?
The InChIKey is WEUJZJHRSBMSCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12ClFN2O5/c1-27-16(24)14-15(22-9-6-7-12(21)11(20)8-9)17(25)28-19(14)10-4-2-3-5-13(10)23-18(19)26/h2-8,22H,1H3,(H,23,26).
What are the key properties of methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate?
methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate has a molecular weight of 402.77 g/mol, XLogP of 2.72, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4'-(3-chloro-4-fluoroanilino)-2,5'-dioxospiro[1H-indole-3,2'-furan]-3'-carboxylate is sourced from PubChem (CID 172994564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).