C8H5Cl2NO — CID 719018
3,3-dichloro-1H-indol-2-one (PubChem CID 719018) has the molecular formula C8H5Cl2NO and a molecular weight of 202.04 g/mol. Its IUPAC name is 3,3-dichloro-1H-indol-2-one.
| Compound Name | 3,3-dichloro-1H-indol-2-one |
|---|---|
| PubChem CID | 719018 |
| Molecular Formula | C8H5Cl2NO |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.97 |
| IUPAC Name | 3,3-dichloro-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2C1(Cl)Cl |
| InChI | InChI=1S/C8H5Cl2NO/c9-8(10)5-3-1-2-4-6(5)11-7(8)12/h1-4H,(H,11,12) |
| InChIKey | WGGLCBPNOIWKDL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|