C10H7N3O3 — CID 15554858
spiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione (PubChem CID 15554858) has the molecular formula C10H7N3O3 and a molecular weight of 217.18 g/mol. Its IUPAC name is spiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione.
| Compound Name | spiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione |
|---|---|
| PubChem CID | 15554858 |
| Molecular Formula | C10H7N3O3 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | spiro[1H-indole-3,5'-imidazolidine]-2,2',4'-trione |
| SMILES | O=C1NC(=O)C2(N1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C10H7N3O3/c14-7-10(8(15)12-9(16)13-10)5-3-1-2-4-6(5)11-7/h1-4H,(H,11,14)(H2,12,13,15,16) |
| InChIKey | VCZILNWKBJBQGN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|