About molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one
molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one (PubChem CID 145209538) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one.
Analyze molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one?
The IUPAC name of molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one (CID 145209538) is molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one.
What is the SMILES notation for molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one?
The canonical SMILES for molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one is O=C1Nc2ccccc2C12CCC2.[H][H].
What is the InChIKey of molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one?
The InChIKey is NSVOQTAFBPHHID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO.H2/c13-10-11(6-3-7-11)8-4-1-2-5-9(8)12-10;/h1-2,4-5H,3,6-7H2,(H,12,13);1H.
What are the key properties of molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one?
molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one has a molecular weight of 175.23 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;spiro[1H-indole-3,1'-cyclobutane]-2-one is sourced from PubChem (CID 145209538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).