C18H24N2O — CID 134788957
1'-(cyclohexylmethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 134788957) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 1'-(cyclohexylmethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 1'-(cyclohexylmethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 134788957 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1'-(cyclohexylmethyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2ccccc2C12CCN(CC1CCCCC1)C2 |
| InChI | InChI=1S/C18H24N2O/c21-17-18(15-8-4-5-9-16(15)19-17)10-11-20(13-18)12-14-6-2-1-3-7-14/h4-5,8-9,14H,1-3,6-7,10-13H2,(H,19,21) |
| InChIKey | CFMWXMRTRKFIPH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |