About 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide
2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide (PubChem CID 154879377) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide.
Molecular Properties
| Compound Name | 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide |
| PubChem CID | 154879377 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide |
| SMILES | NC(=O)N1CCC2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C12H13N3O2/c13-11(17)15-6-5-12(7-15)8-3-1-2-4-9(8)14-10(12)16/h1-4H,5-7H2,(H2,13,17)(H,14,16) |
| InChIKey | XAEWXEWQOYJIFK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide?
The IUPAC name of 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide (CID 154879377) is 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide.
What is the SMILES notation for 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide?
The canonical SMILES for 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide is NC(=O)N1CCC2(C1)C(=O)Nc1ccccc12.
What is the InChIKey of 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide?
The InChIKey is XAEWXEWQOYJIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c13-11(17)15-6-5-12(7-15)8-3-1-2-4-9(8)14-10(12)16/h1-4H,5-7H2,(H2,13,17)(H,14,16).
What are the key properties of 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide?
2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide has a molecular weight of 231.25 g/mol, XLogP of 0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-carboxamide is sourced from PubChem (CID 154879377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).