C16H18N2O3 — CID 156901883
1'-(oxetane-2-carbonyl)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 156901883) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1'-(oxetane-2-carbonyl)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-(oxetane-2-carbonyl)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 156901883 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1'-(oxetane-2-carbonyl)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | O=C(C1CCO1)N1CCC2(CC1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C16H18N2O3/c19-14(13-5-10-21-13)18-8-6-16(7-9-18)11-3-1-2-4-12(11)17-15(16)20/h1-4,13H,5-10H2,(H,17,20) |
| InChIKey | BSNALOMRYMSFMK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |