C22H29BN2O5 — CID 156901901
1'-(oxetane-2-carbonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 156901901) has the molecular formula C22H29BN2O5 and a molecular weight of 412.30 g/mol. Its IUPAC name is 1'-(oxetane-2-carbonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-(oxetane-2-carbonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 156901901 |
| Molecular Formula | C22H29BN2O5 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1'-(oxetane-2-carbonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)NC(=O)C32CCN(C(=O)C3CCO3)CC2)OC1(C)C |
| InChI | InChI=1S/C22H29BN2O5/c1-20(2)21(3,4)30-23(29-20)14-5-6-15-16(13-14)24-19(27)22(15)8-10-25(11-9-22)18(26)17-7-12-28-17/h5-6,13,17H,7-12H2,1-4H3,(H,24,27) |
| InChIKey | VGNNKQUIGLZYDW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|