C29H42BN3O4 — CID 149445666
1'-acetyl-1-(3-piperidin-1-ylcyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 149445666) has the molecular formula C29H42BN3O4 and a molecular weight of 507.48 g/mol. Its IUPAC name is 1'-acetyl-1-(3-piperidin-1-ylcyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-acetyl-1-(3-piperidin-1-ylcyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 149445666 |
| Molecular Formula | C29H42BN3O4 |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | 1'-acetyl-1-(3-piperidin-1-ylcyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CC(=O)N1CCC2(CC1)C(=O)N(C1CC(N3CCCCC3)C1)c1cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C29H42BN3O4/c1-20(34)31-15-11-29(12-16-31)24-10-9-21(30-36-27(2,3)28(4,5)37-30)17-25(24)33(26(29)35)23-18-22(19-23)32-13-7-6-8-14-32/h9-10,17,22-23H,6-8,11-16,18-19H2,1-5H3 |
| InChIKey | YWQFDBXTXFDPCJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|