C30H40BN3O5 — CID 174036350
1-[3-(2-oxa-5-azabicyclo[2.2.1]hept-1(6)-en-5-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 174036350) has the molecular formula C30H40BN3O5 and a molecular weight of 533.48 g/mol. Its IUPAC name is 1-[3-(2-oxa-5-azabicyclo[2.2.1]hept-1(6)-en-5-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1-[3-(2-oxa-5-azabicyclo[2.2.1]hept-1(6)-en-5-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 174036350 |
| Molecular Formula | C30H40BN3O5 |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | 1-[3-(2-oxa-5-azabicyclo[2.2.1]hept-1(6)-en-5-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)N(C2CC(N4C=C5CC4CO5)C2)C(=O)C32CCN(C3COC3)CC2)OC1(C)C |
| InChI | InChI=1S/C30H40BN3O5/c1-28(2)29(3,4)39-31(38-28)19-5-6-25-26(11-19)34(21-12-20(13-21)33-15-24-14-22(33)18-37-24)27(35)30(25)7-9-32(10-8-30)23-16-36-17-23/h5-6,11,15,20-23H,7-10,12-14,16-18H2,1-4H3 |
| InChIKey | WNDUSHZVDDBHAE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|