C33H48BN3O5 — CID 153498487
1-[3-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]-1'-[(2R)-oxolane-2-carbonyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 153498487) has the molecular formula C33H48BN3O5 and a molecular weight of 577.58 g/mol. Its IUPAC name is 1-[3-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]-1'-[(2R)-oxolane-2-carbonyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1-[3-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]-1'-[(2R)-oxolane-2-carbonyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 153498487 |
| Molecular Formula | C33H48BN3O5 |
| Molecular Weight | 577.58 g/mol |
| Exact Mass | 577.37 |
| IUPAC Name | 1-[3-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]-1'-[(2R)-oxolane-2-carbonyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CC1(C)CCN(C2CC(N3C(=O)C4(CCN(C(=O)[C@H]5CCCO5)CC4)c4ccc(B5OC(C)(C)C(C)(C)O5)cc43)C2)C1 |
| InChI | InChI=1S/C33H48BN3O5/c1-30(2)11-14-36(21-30)23-19-24(20-23)37-26-18-22(34-41-31(3,4)32(5,6)42-34)9-10-25(26)33(29(37)39)12-15-35(16-13-33)28(38)27-8-7-17-40-27/h9-10,18,23-24,27H,7-8,11-17,19-21H2,1-6H3/t23?,24?,27-/m1/s1 |
| InChIKey | PFRFABRJWSRVCO-PUUKEUDRSA-N |
| XLogP | 3.63 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|