C31H46BN3O4 — CID 153498480
1-[3-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 153498480) has the molecular formula C31H46BN3O4 and a molecular weight of 535.54 g/mol. Its IUPAC name is 1-[3-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1-[3-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 153498480 |
| Molecular Formula | C31H46BN3O4 |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.36 |
| IUPAC Name | 1-[3-(3,3-dimethylpyrrolidin-1-yl)cyclobutyl]-1'-(oxetan-3-yl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | CC1(C)CCN(C2CC(N3C(=O)C4(CCN(C5COC5)CC4)c4ccc(B5OC(C)(C)C(C)(C)O5)cc43)C2)C1 |
| InChI | InChI=1S/C31H46BN3O4/c1-28(2)9-12-34(20-28)22-16-23(17-22)35-26-15-21(32-38-29(3,4)30(5,6)39-32)7-8-25(26)31(27(35)36)10-13-33(14-11-31)24-18-37-19-24/h7-8,15,22-24H,9-14,16-20H2,1-6H3 |
| InChIKey | ISZGWVXNIZNZKX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|