C34H50BN3O5 — CID 149113192
tert-butyl 1-[3-(5-azaspiro[2.5]octan-5-yl)cyclobutyl]-2-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-1'-carboxylate (PubChem CID 149113192) has the molecular formula C34H50BN3O5 and a molecular weight of 591.60 g/mol. Its IUPAC name is tert-butyl 1-[3-(5-azaspiro[2.5]octan-5-yl)cyclobutyl]-2-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 1-[3-(5-azaspiro[2.5]octan-5-yl)cyclobutyl]-2-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 149113192 |
| Molecular Formula | C34H50BN3O5 |
| Molecular Weight | 591.60 g/mol |
| Exact Mass | 591.38 |
| IUPAC Name | tert-butyl 1-[3-(5-azaspiro[2.5]octan-5-yl)cyclobutyl]-2-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C(=O)N(C1CC(N3CCCC4(CC4)C3)C1)c1cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C34H50BN3O5/c1-30(2,3)41-29(40)36-17-14-34(15-18-36)26-10-9-23(35-42-31(4,5)32(6,7)43-35)19-27(26)38(28(34)39)25-20-24(21-25)37-16-8-11-33(22-37)12-13-33/h9-10,19,24-25H,8,11-18,20-22H2,1-7H3 |
| InChIKey | QXTSPLAAXIVQEX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|