C32H45BFN3O4 — CID 174036352
1'-(4-fluoro-2-methylidenebutanoyl)-1-(3-piperidin-1-ylcyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one (PubChem CID 174036352) has the molecular formula C32H45BFN3O4 and a molecular weight of 565.54 g/mol. Its IUPAC name is 1'-(4-fluoro-2-methylidenebutanoyl)-1-(3-piperidin-1-ylcyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-(4-fluoro-2-methylidenebutanoyl)-1-(3-piperidin-1-ylcyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 174036352 |
| Molecular Formula | C32H45BFN3O4 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | 1'-(4-fluoro-2-methylidenebutanoyl)-1-(3-piperidin-1-ylcyclobutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[indole-3,4'-piperidine]-2-one |
| SMILES | C=C(CCF)C(=O)N1CCC2(CC1)C(=O)N(C1CC(N3CCCCC3)C1)c1cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C32H45BFN3O4/c1-22(11-14-34)28(38)36-17-12-32(13-18-36)26-10-9-23(33-40-30(2,3)31(4,5)41-33)19-27(26)37(29(32)39)25-20-24(21-25)35-15-7-6-8-16-35/h9-10,19,24-25H,1,6-8,11-18,20-21H2,2-5H3 |
| InChIKey | LUTSMSAFSJVJQA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|