C24H33BN2O5 — CID 156901877
1'-(oxane-4-carbonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 156901877) has the molecular formula C24H33BN2O5 and a molecular weight of 440.35 g/mol. Its IUPAC name is 1'-(oxane-4-carbonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-(oxane-4-carbonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 156901877 |
| Molecular Formula | C24H33BN2O5 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 1'-(oxane-4-carbonyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)NC(=O)C32CCN(C(=O)C3CCOCC3)CC2)OC1(C)C |
| InChI | InChI=1S/C24H33BN2O5/c1-22(2)23(3,4)32-25(31-22)17-5-6-18-19(15-17)26-21(29)24(18)9-11-27(12-10-24)20(28)16-7-13-30-14-8-16/h5-6,15-16H,7-14H2,1-4H3,(H,26,29) |
| InChIKey | WJVYTZGZXGIPPG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|