C25H31BN2O3 — CID 133058584
1'-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 133058584) has the molecular formula C25H31BN2O3 and a molecular weight of 418.35 g/mol. Its IUPAC name is 1'-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 133058584 |
| Molecular Formula | C25H31BN2O3 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1'-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)C2(CCN(Cc4ccccc4)CC2)C(=O)N3)OC1(C)C |
| InChI | InChI=1S/C25H31BN2O3/c1-23(2)24(3,4)31-26(30-23)19-10-11-21-20(16-19)25(22(29)27-21)12-14-28(15-13-25)17-18-8-6-5-7-9-18/h5-11,16H,12-15,17H2,1-4H3,(H,27,29) |
| InChIKey | XTMLLPBGJVJMSZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|