C33H40BNO4 — CID 145440096
(1-benzylpiperidin-4-yl)methyl 2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (PubChem CID 145440096) has the molecular formula C33H40BNO4 and a molecular weight of 525.50 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl)methyl 2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate.
| Compound Name | (1-benzylpiperidin-4-yl)methyl 2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 145440096 |
| Molecular Formula | C33H40BNO4 |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | (1-benzylpiperidin-4-yl)methyl 2-phenyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| SMILES | CC1(C)OB(c2ccc(C(C(=O)OCC3CCN(Cc4ccccc4)CC3)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C33H40BNO4/c1-32(2)33(3,4)39-34(38-32)29-17-15-28(16-18-29)30(27-13-9-6-10-14-27)31(36)37-24-26-19-21-35(22-20-26)23-25-11-7-5-8-12-25/h5-18,26,30H,19-24H2,1-4H3 |
| InChIKey | AWRSIBWSNJUIEM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|