C21H29BN4O2 — CID 165340663
2-[4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazin-1-yl]pyrimidine (PubChem CID 165340663) has the molecular formula C21H29BN4O2 and a molecular weight of 380.30 g/mol. Its IUPAC name is 2-[4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 165340663 |
| Molecular Formula | C21H29BN4O2 |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 2-[4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazin-1-yl]pyrimidine |
| SMILES | CC1(C)OB(c2ccc(CN3CCN(c4ncccn4)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C21H29BN4O2/c1-20(2)21(3,4)28-22(27-20)18-8-6-17(7-9-18)16-25-12-14-26(15-13-25)19-23-10-5-11-24-19/h5-11H,12-16H2,1-4H3 |
| InChIKey | VBOWPXCVHNFJEU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|