C20H28BN3O2S — CID 113249412
2-[4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazin-1-yl]-1,3-thiazole (PubChem CID 113249412) has the molecular formula C20H28BN3O2S and a molecular weight of 385.34 g/mol. Its IUPAC name is 2-[4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 113249412 |
| Molecular Formula | C20H28BN3O2S |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-[4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazin-1-yl]-1,3-thiazole |
| SMILES | CC1(C)OB(c2cccc(CN3CCN(c4nccs4)CC3)c2)OC1(C)C |
| InChI | InChI=1S/C20H28BN3O2S/c1-19(2)20(3,4)26-21(25-19)17-7-5-6-16(14-17)15-23-9-11-24(12-10-23)18-22-8-13-27-18/h5-8,13-14H,9-12,15H2,1-4H3 |
| InChIKey | KWOJKJMUEASPCM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|