C22H30BN3O2 — CID 11143376
1-pyridin-2-yl-4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine (PubChem CID 11143376) has the molecular formula C22H30BN3O2 and a molecular weight of 379.31 g/mol. Its IUPAC name is 1-pyridin-2-yl-4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine.
| Compound Name | 1-pyridin-2-yl-4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 11143376 |
| Molecular Formula | C22H30BN3O2 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-pyridin-2-yl-4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine |
| SMILES | CC1(C)OB(c2ccccc2CN2CCN(c3ccccn3)CC2)OC1(C)C |
| InChI | InChI=1S/C22H30BN3O2/c1-21(2)22(3,4)28-23(27-21)19-10-6-5-9-18(19)17-25-13-15-26(16-14-25)20-11-7-8-12-24-20/h5-12H,13-17H2,1-4H3 |
| InChIKey | GKYQNVNKOYDBPB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|