C19H25N3O3 — CID 791258
1-pyridin-2-yl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine (PubChem CID 791258) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-pyridin-2-yl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-pyridin-2-yl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 791258 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-pyridin-2-yl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCN(c3ccccn3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C19H25N3O3/c1-23-16-8-7-15(18(24-2)19(16)25-3)14-21-10-12-22(13-11-21)17-6-4-5-9-20-17/h4-9H,10-14H2,1-3H3 |
| InChIKey | ATSXNZSSMNRUQP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |