C24H34N4O5 — CID 23441412
7-[2,3-dimethoxy-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenoxy]heptanoic acid (PubChem CID 23441412) has the molecular formula C24H34N4O5 and a molecular weight of 458.56 g/mol. Its IUPAC name is 7-[2,3-dimethoxy-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenoxy]heptanoic acid.
| Compound Name | 7-[2,3-dimethoxy-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenoxy]heptanoic acid |
|---|---|
| PubChem CID | 23441412 |
| Molecular Formula | C24H34N4O5 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 7-[2,3-dimethoxy-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenoxy]heptanoic acid |
| SMILES | COc1ccc(CN2CCN(c3ncccn3)CC2)c(OCCCCCCC(=O)O)c1OC |
| InChI | InChI=1S/C24H34N4O5/c1-31-20-10-9-19(18-27-13-15-28(16-14-27)24-25-11-7-12-26-24)22(23(20)32-2)33-17-6-4-3-5-8-21(29)30/h7,9-12H,3-6,8,13-18H2,1-2H3,(H,29,30) |
| InChIKey | ZZUXRQNJFCCJDV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|