C28H34N2O5 — CID 55713085
4-naphthalen-1-yloxy-1-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butan-1-one (PubChem CID 55713085) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is 4-naphthalen-1-yloxy-1-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-naphthalen-1-yloxy-1-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 55713085 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 4-naphthalen-1-yloxy-1-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butan-1-one |
| SMILES | COc1ccc(CN2CCN(C(=O)CCCOc3cccc4ccccc34)CC2)c(OC)c1OC |
| InChI | InChI=1S/C28H34N2O5/c1-32-25-14-13-22(27(33-2)28(25)34-3)20-29-15-17-30(18-16-29)26(31)12-7-19-35-24-11-6-9-21-8-4-5-10-23(21)24/h4-6,8-11,13-14H,7,12,15-20H2,1-3H3 |
| InChIKey | LXLFEOOYBZYEQF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|