C22H33N3O5 — CID 39953095
N-[4-oxo-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butyl]cyclopropanecarboxamide (PubChem CID 39953095) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is N-[4-oxo-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butyl]cyclopropanecarboxamide.
| Compound Name | N-[4-oxo-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 39953095 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | N-[4-oxo-4-[4-[(2,3,4-trimethoxyphenyl)methyl]piperazin-1-yl]butyl]cyclopropanecarboxamide |
| SMILES | COc1ccc(CN2CCN(C(=O)CCCNC(=O)C3CC3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C22H33N3O5/c1-28-18-9-8-17(20(29-2)21(18)30-3)15-24-11-13-25(14-12-24)19(26)5-4-10-23-22(27)16-6-7-16/h8-9,16H,4-7,10-15H2,1-3H3,(H,23,27) |
| InChIKey | CUHZWSFFJFLZQX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|